PRODUCTS
PRODUCTS
Ethyl acetate |
| Product name: | Ethyl acetate |
| CAS No.: | 141-78-6 |
| EINECS No.: | 205-500-4 |
| Molecular weight: | 88.1051 |
| Molecular formula: | C4H8O2 |
| InChI: | InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
| Structural formula: |  |
| Density: | 0.898g/cm3 |
| Melting point: | -83.5℃ |
| Water solubility: | 80 g/L (20℃) |
| Boiling point: | 73.9°C at 760 mmHg |
| Flash point: | 4℃ |
| Vapor pressure: | 112mmHg at 25°C |
| Uses: | It can be used to dissolve nitrocellulose, ink, grease, etc., and can also be used in paint, artificial leather, plastic products, dyes, medicines and spices, etc |
